Products 1784249-40-6

CAS 1784249-40-6 is the registry number for 2-Ethoxythiazole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-ethoxy-1,3-thiazole-4-carboxylic acid (CAS 1784249-40-6) is a chemical compound with the molecular formula C6H7NO3S and a molecular weight of 173.19 g/mol. IUPAC name: 2-ethoxy-1,3-thiazole-4-carboxylic acid. InChIKey: IJPUOSSOGGXQQU-UHFFFAOYSA-N.

Identity
Molecular formulaC6H7NO3S
Molecular weight173.19 g/mol
IUPAC name2-ethoxy-1,3-thiazole-4-carboxylic acid
InChIKeyIJPUOSSOGGXQQU-UHFFFAOYSA-N
SMILESCCOC1=NC(=CS1)C(=O)O

Computed by PubChem (NCBI)