CAS 178427-43-5 is the registry number for 2'-Deoxy-N-(3-oxo-1-propenyl)adenosine, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg, 5mg.
(E)-3-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]prop-2-enal (CAS 178427-43-5) is a chemical compound with the molecular formula C13H15N5O4 and a molecular weight of 305.29 g/mol. IUPAC name: (E)-3-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]prop-2-enal. InChIKey: YCTVDHFYRBOGFS-HFVMFMDWSA-N.
| Molecular formula | C13H15N5O4 |
|---|---|
| Molecular weight | 305.29 g/mol |
| IUPAC name | (E)-3-[[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-6-yl]amino]prop-2-enal |
| InChIKey | YCTVDHFYRBOGFS-HFVMFMDWSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C(N=CN=C32)N/C=C/C=O)CO)O |
Computed by PubChem (NCBI)