CAS 1784368-17-7 is the registry number for 5-Bromo-4-methoxy-2-(methylsulfonyl)pyrimidine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
5-bromo-4-methoxy-2-methylsulfonylpyrimidine (CAS 1784368-17-7) is a chemical compound with the molecular formula C6H7BrN2O3S and a molecular weight of 267.10 g/mol. IUPAC name: 5-bromo-4-methoxy-2-methylsulfonylpyrimidine. InChIKey: QXSYMXDJTNSVCR-UHFFFAOYSA-N.
| Molecular formula | C6H7BrN2O3S |
|---|---|
| Molecular weight | 267.10 g/mol |
| IUPAC name | 5-bromo-4-methoxy-2-methylsulfonylpyrimidine |
| InChIKey | QXSYMXDJTNSVCR-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC=C1Br)S(=O)(=O)C |
Computed by PubChem (NCBI)