Products 178440-22-7
CAS 178440-22-7 is the registry number for (1-Ethoxy-2,2-dimethylcyclopropoxy)trimethylsilane, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g.
(1-ethoxy-2,2-dimethylcyclopropyl)oxy-trimethylsilane (CAS 178440-22-7) is a chemical compound with the molecular formula C10H22O2Si and a molecular weight of 202.37 g/mol. IUPAC name: (1-ethoxy-2,2-dimethylcyclopropyl)oxy-trimethylsilane. InChIKey: MCXGHANREPGGGX-UHFFFAOYSA-N.
| Molecular formula | C10H22O2Si |
|---|---|
| Molecular weight | 202.37 g/mol |
| IUPAC name | (1-ethoxy-2,2-dimethylcyclopropyl)oxy-trimethylsilane |
| InChIKey | MCXGHANREPGGGX-UHFFFAOYSA-N |
| SMILES | CCOC1(CC1(C)C)O[Si](C)(C)C |
Computed by PubChem (NCBI)