Products 1784557-02-3
CAS 1784557-02-3 appears in our catalog under these names: 3–(1，1–difluoro–2–hydroxyethyl)phenol, 3-(1,1-difluoro-2-hydroxyethyl)phenol. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg, 25g.
3-(1,1-difluoro-2-hydroxyethyl)phenol (CAS 1784557-02-3) is a chemical compound with the molecular formula C8H8F2O2 and a molecular weight of 174.14 g/mol. IUPAC name: 3-(1,1-difluoro-2-hydroxyethyl)phenol. InChIKey: LAGNSTKGZBLWOE-UHFFFAOYSA-N.
| Molecular formula | C8H8F2O2 |
|---|---|
| Molecular weight | 174.14 g/mol |
| IUPAC name | 3-(1,1-difluoro-2-hydroxyethyl)phenol |
| InChIKey | LAGNSTKGZBLWOE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)O)C(CO)(F)F |
Computed by PubChem (NCBI)