CAS 178456-36-5 appears in our catalog under these names: O-Acetyl Abacavir, >95% (HPLC), O-Acetylabacavir. Offered by: TRC, Mikromol. Available pack sizes: 100mg, 10mg, 50mg, 25mg.
[(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methyl acetate (CAS 178456-36-5) is a chemical compound with the molecular formula C16H20N6O2 and a molecular weight of 328.37 g/mol. IUPAC name: [(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methyl acetate. InChIKey: IZAFXYKTLWYNFW-PWSUYJOCSA-N.
| Molecular formula | C16H20N6O2 |
|---|---|
| Molecular weight | 328.37 g/mol |
| IUPAC name | [(1S,4R)-4-[2-amino-6-(cyclopropylamino)purin-9-yl]cyclopent-2-en-1-yl]methyl acetate |
| InChIKey | IZAFXYKTLWYNFW-PWSUYJOCSA-N |
| SMILES | CC(=O)OC[C@H]1C[C@H](C=C1)N2C=NC3=C(N=C(N=C32)N)NC4CC4 |
Computed by PubChem (NCBI)