Products 1784747-51-8
CAS 1784747-51-8 is the registry number for methyl (3R,4S)-4-(4-methoxyphenyl)-2-oxo-pyrrolidine-3-carboxylate, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl (3R,4S)-4-(4-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate (CAS 1784747-51-8) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: methyl (3R,4S)-4-(4-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate. InChIKey: DEQYSMOBGAWMAL-GHMZBOCLSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | methyl (3R,4S)-4-(4-methoxyphenyl)-2-oxopyrrolidine-3-carboxylate |
| InChIKey | DEQYSMOBGAWMAL-GHMZBOCLSA-N |
| SMILES | COC1=CC=C(C=C1)[C@H]2CNC(=O)[C@@H]2C(=O)OC |
Computed by PubChem (NCBI)