Products 1784748-07-7
CAS 1784748-07-7 is the registry number for Rel-(3R,4S)-4-(6-fluoro-2,3-dihydro-1H-inden-5-yl)-2-oxopyrrolidine-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R,4S)-4-(6-fluoro-2,3-dihydro-1H-inden-5-yl)-2-oxopyrrolidine-3-carboxylic acid (CAS 1784748-07-7) is a chemical compound with the molecular formula C14H14FNO3 and a molecular weight of 263.26 g/mol. IUPAC name: (3R,4S)-4-(6-fluoro-2,3-dihydro-1H-inden-5-yl)-2-oxopyrrolidine-3-carboxylic acid. InChIKey: QZSUSLSDKPMIBE-ZYHUDNBSSA-N.
| Molecular formula | C14H14FNO3 |
|---|---|
| Molecular weight | 263.26 g/mol |
| IUPAC name | (3R,4S)-4-(6-fluoro-2,3-dihydro-1H-inden-5-yl)-2-oxopyrrolidine-3-carboxylic acid |
| InChIKey | QZSUSLSDKPMIBE-ZYHUDNBSSA-N |
| SMILES | C1CC2=CC(=C(C=C2C1)F)[C@H]3CNC(=O)[C@@H]3C(=O)O |
Computed by PubChem (NCBI)