Products 1159602-14-8

CAS 1159602-14-8 is the registry number for 3-(2-Fluoro-4-methyl-phenyl)-5-methyl-isoxazole-4-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 3-(2-fluoro-4-methylphenyl)-5-methyl-1,2-oxazole-4-carboxylate (CAS 1159602-14-8) is a chemical compound with the molecular formula C14H14FNO3 and a molecular weight of 263.26 g/mol. IUPAC name: ethyl 3-(2-fluoro-4-methylphenyl)-5-methyl-1,2-oxazole-4-carboxylate. InChIKey: VPOARANPDMLKRC-UHFFFAOYSA-N.

Identity
Molecular formulaC14H14FNO3
Molecular weight263.26 g/mol
IUPAC nameethyl 3-(2-fluoro-4-methylphenyl)-5-methyl-1,2-oxazole-4-carboxylate
InChIKeyVPOARANPDMLKRC-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(ON=C1C2=C(C=C(C=C2)C)F)C

Computed by PubChem (NCBI)