CAS 1159602-14-8 is the registry number for 3-(2-Fluoro-4-methyl-phenyl)-5-methyl-isoxazole-4-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 3-(2-fluoro-4-methylphenyl)-5-methyl-1,2-oxazole-4-carboxylate (CAS 1159602-14-8) is a chemical compound with the molecular formula C14H14FNO3 and a molecular weight of 263.26 g/mol. IUPAC name: ethyl 3-(2-fluoro-4-methylphenyl)-5-methyl-1,2-oxazole-4-carboxylate. InChIKey: VPOARANPDMLKRC-UHFFFAOYSA-N.
| Molecular formula | C14H14FNO3 |
|---|---|
| Molecular weight | 263.26 g/mol |
| IUPAC name | ethyl 3-(2-fluoro-4-methylphenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| InChIKey | VPOARANPDMLKRC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(ON=C1C2=C(C=C(C=C2)C)F)C |
Computed by PubChem (NCBI)