CAS 1784751-18-3 appears in our catalog under these names: Ta-01, 95%, TA-01/ 99.94% (existing batch purity), TA 01, TA-01, TA-01 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Biosynth, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 2mg, 5mg, 10mg, 25mg, 50mg.
4-[2-(2,6-difluorophenyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine (CAS 1784751-18-3) is a chemical compound with the molecular formula C20H12F3N3 and a molecular weight of 351.3 g/mol. IUPAC name: 4-[2-(2,6-difluorophenyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine. InChIKey: TWPJJJZCYVFUOA-UHFFFAOYSA-N.
| Molecular formula | C20H12F3N3 |
|---|---|
| Molecular weight | 351.3 g/mol |
| IUPAC name | 4-[2-(2,6-difluorophenyl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine |
| InChIKey | TWPJJJZCYVFUOA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=NC(=C(N2)C3=CC=NC=C3)C4=CC=C(C=C4)F)F |
Computed by PubChem (NCBI)