CAS 1784902-43-7 is the registry number for 3-((2,2,2-Trifluoroethyl)sulfonyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,2,2-trifluoroethylsulfonyl)pyrrolidine (CAS 1784902-43-7) is a chemical compound with the molecular formula C6H10F3NO2S and a molecular weight of 217.21 g/mol. IUPAC name: 3-(2,2,2-trifluoroethylsulfonyl)pyrrolidine. InChIKey: MJIFDHALJPWDON-UHFFFAOYSA-N.
| Molecular formula | C6H10F3NO2S |
|---|---|
| Molecular weight | 217.21 g/mol |
| IUPAC name | 3-(2,2,2-trifluoroethylsulfonyl)pyrrolidine |
| InChIKey | MJIFDHALJPWDON-UHFFFAOYSA-N |
| SMILES | C1CNCC1S(=O)(=O)CC(F)(F)F |
Computed by PubChem (NCBI)