CAS 1784977-53-2 is the registry number for 7-bromoindan-5-ol, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
7-bromo-2,3-dihydro-1H-inden-5-ol (CAS 1784977-53-2) is a chemical compound with the molecular formula C9H9BrO and a molecular weight of 213.07 g/mol. IUPAC name: 7-bromo-2,3-dihydro-1H-inden-5-ol. InChIKey: SUOZSECMQPXJSX-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO |
|---|---|
| Molecular weight | 213.07 g/mol |
| IUPAC name | 7-bromo-2,3-dihydro-1H-inden-5-ol |
| InChIKey | SUOZSECMQPXJSX-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1)C(=CC(=C2)O)Br |
Computed by PubChem (NCBI)