CAS 1785-64-4 appears in our catalog under these names: Parylene f dimer, 95%, 4,5,7,8,12,13,15,16–Octafluoro(2·2)paracyclophane, 4,5,7,8,12,13,15,16-Octafluoro[2.2]paracyclophane, >98.0%(GC), Parylene F Dimer 97%, Parylene F Dimer, 97%, 97%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10g, 25g, 5g, 1g, 100g.
5,6,11,12,13,14,15,16-octafluorotricyclo[8.2.2.24,7]hexadeca-1(12),4(16),5,7(15),10,13-hexaene (CAS 1785-64-4) is a chemical compound with the molecular formula C16H8F8 and a molecular weight of 352.22 g/mol. IUPAC name: 5,6,11,12,13,14,15,16-octafluorotricyclo[8.2.2.24,7]hexadeca-1(12),4(16),5,7(15),10,13-hexaene. InChIKey: GUHKMHMGKKRFDT-UHFFFAOYSA-N.
| Molecular formula | C16H8F8 |
|---|---|
| Molecular weight | 352.22 g/mol |
| IUPAC name | 5,6,11,12,13,14,15,16-octafluorotricyclo[8.2.2.24,7]hexadeca-1(12),4(16),5,7(15),10,13-hexaene |
| InChIKey | GUHKMHMGKKRFDT-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=C(CCC3=C(C(=C1C(=C3F)F)F)F)C(=C2F)F)F)F |
Computed by PubChem (NCBI)