CAS 1785014-14-3 appears in our catalog under these names: 2–(4–(tert–butyl)phenyl)–2,2–difluoroethan–1–ol, 2-(4-tert-butylphenyl)-2,2-difluoroethan-1-ol, 2-(4-(tert-butyl)phenyl)-2,2-difluoroethan-1-ol, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg.
2-(4-tert-butylphenyl)-2,2-difluoroethanol (CAS 1785014-14-3) is a chemical compound with the molecular formula C12H16F2O and a molecular weight of 214.25 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-2,2-difluoroethanol. InChIKey: ISKWXRDAAVLOKL-UHFFFAOYSA-N.
| Molecular formula | C12H16F2O |
|---|---|
| Molecular weight | 214.25 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-2,2-difluoroethanol |
| InChIKey | ISKWXRDAAVLOKL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C(CO)(F)F |
Computed by PubChem (NCBI)