Products 1785125-34-9

CAS 1785125-34-9 appears in our catalog under these names: 3,3-Difluoro-1-methylcyclopentane-1-carboxylic acid, 95%, 3,3-Difluoro-1-methylcyclopentane-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

3,3-difluoro-1-methylcyclopentane-1-carboxylic acid (CAS 1785125-34-9) is a chemical compound with the molecular formula C7H10F2O2 and a molecular weight of 164.15 g/mol. IUPAC name: 3,3-difluoro-1-methylcyclopentane-1-carboxylic acid. InChIKey: RQOUOWUWKACQCO-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10F2O2
Molecular weight164.15 g/mol
IUPAC name3,3-difluoro-1-methylcyclopentane-1-carboxylic acid
InChIKeyRQOUOWUWKACQCO-UHFFFAOYSA-N
SMILESCC1(CCC(C1)(F)F)C(=O)O

Computed by PubChem (NCBI)