CAS 1785222-27-6 is the registry number for 1-(2-Bromo-4-chlorophenyl)-1h-imidazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
1-(2-bromo-4-chlorophenyl)imidazole (CAS 1785222-27-6) is a chemical compound with the molecular formula C9H6BrClN2 and a molecular weight of 257.51 g/mol. IUPAC name: 1-(2-bromo-4-chlorophenyl)imidazole. InChIKey: PUWIEMUQSYAHIP-UHFFFAOYSA-N.
| Molecular formula | C9H6BrClN2 |
|---|---|
| Molecular weight | 257.51 g/mol |
| IUPAC name | 1-(2-bromo-4-chlorophenyl)imidazole |
| InChIKey | PUWIEMUQSYAHIP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Br)N2C=CN=C2 |
Computed by PubChem (NCBI)