Products 1785259-40-6

CAS 1785259-40-6 appears in our catalog under these names: 3-Fluoro-2,4,6-trimethylbenzene-1-sulfonyl chloride, 95%, 3-Fluoro-2,4,6-trimethylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-fluoro-2,4,6-trimethylbenzenesulfonyl chloride (CAS 1785259-40-6) is a chemical compound with the molecular formula C9H10ClFO2S and a molecular weight of 236.69 g/mol. IUPAC name: 3-fluoro-2,4,6-trimethylbenzenesulfonyl chloride. InChIKey: ILWRQBDMMUXIQV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10ClFO2S
Molecular weight236.69 g/mol
IUPAC name3-fluoro-2,4,6-trimethylbenzenesulfonyl chloride
InChIKeyILWRQBDMMUXIQV-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1F)C)S(=O)(=O)Cl)C

Computed by PubChem (NCBI)