CAS 1785259-40-6 appears in our catalog under these names: 3-Fluoro-2,4,6-trimethylbenzene-1-sulfonyl chloride, 95%, 3-Fluoro-2,4,6-trimethylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-fluoro-2,4,6-trimethylbenzenesulfonyl chloride (CAS 1785259-40-6) is a chemical compound with the molecular formula C9H10ClFO2S and a molecular weight of 236.69 g/mol. IUPAC name: 3-fluoro-2,4,6-trimethylbenzenesulfonyl chloride. InChIKey: ILWRQBDMMUXIQV-UHFFFAOYSA-N.
| Molecular formula | C9H10ClFO2S |
|---|---|
| Molecular weight | 236.69 g/mol |
| IUPAC name | 3-fluoro-2,4,6-trimethylbenzenesulfonyl chloride |
| InChIKey | ILWRQBDMMUXIQV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1F)C)S(=O)(=O)Cl)C |
Computed by PubChem (NCBI)