CAS 1785326-62-6 is the registry number for 6-Ethyl-3,3-dimethyl-1,2,3,4-tetrahydroquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-ethyl-3,3-dimethyl-2,4-dihydro-1H-quinoline (CAS 1785326-62-6) is a chemical compound with the molecular formula C13H19N and a molecular weight of 189.30 g/mol. IUPAC name: 6-ethyl-3,3-dimethyl-2,4-dihydro-1H-quinoline. InChIKey: BECPZCZJDZNJME-UHFFFAOYSA-N.
| Molecular formula | C13H19N |
|---|---|
| Molecular weight | 189.30 g/mol |
| IUPAC name | 6-ethyl-3,3-dimethyl-2,4-dihydro-1H-quinoline |
| InChIKey | BECPZCZJDZNJME-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C=C1)NCC(C2)(C)C |
Computed by PubChem (NCBI)