Products 1785516-22-4
CAS 1785516-22-4 is the registry number for 2-BROMO-3,4,6-TRIFLUOROPHENOL, 99%, 99%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
2-bromo-3,4,6-trifluorophenol (CAS 1785516-22-4) is a chemical compound with the molecular formula C6H2BrF3O and a molecular weight of 226.98 g/mol. IUPAC name: 2-bromo-3,4,6-trifluorophenol. InChIKey: CWHIJPFUVHVVQQ-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF3O |
|---|---|
| Molecular weight | 226.98 g/mol |
| IUPAC name | 2-bromo-3,4,6-trifluorophenol |
| InChIKey | CWHIJPFUVHVVQQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)Br)O)F |
Computed by PubChem (NCBI)