CAS 192446-70-1 appears in our catalog under these names: 4-Bromo-2,3,6-trifluorophenol, ≥95%, ≥95%, 4-Bromo-2,3,6-trifluorophenol, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g.
4-bromo-2,3,6-trifluorophenol (CAS 192446-70-1) is a chemical compound with the molecular formula C6H2BrF3O and a molecular weight of 226.98 g/mol. IUPAC name: 4-bromo-2,3,6-trifluorophenol. InChIKey: ZFHGAOPLTHSAQQ-UHFFFAOYSA-N.
| Molecular formula | C6H2BrF3O |
|---|---|
| Molecular weight | 226.98 g/mol |
| IUPAC name | 4-bromo-2,3,6-trifluorophenol |
| InChIKey | ZFHGAOPLTHSAQQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1Br)F)F)O)F |
Computed by PubChem (NCBI)