Products 178557-12-5

CAS 178557-12-5 is the registry number for 1,4-Bis(2-chloroethoxy)-2,5-dibromobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,4-dibromo-2,5-bis(2-chloroethoxy)benzene (CAS 178557-12-5) is a chemical compound with the molecular formula C10H10Br2Cl2O2 and a molecular weight of 392.90 g/mol. IUPAC name: 1,4-dibromo-2,5-bis(2-chloroethoxy)benzene. InChIKey: IGJLUNFUSYBNGH-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10Br2Cl2O2
Molecular weight392.90 g/mol
IUPAC name1,4-dibromo-2,5-bis(2-chloroethoxy)benzene
InChIKeyIGJLUNFUSYBNGH-UHFFFAOYSA-N
SMILESC1=C(C(=CC(=C1Br)OCCCl)Br)OCCCl

Computed by PubChem (NCBI)