CAS 178557-12-5 is the registry number for 1,4-Bis(2-chloroethoxy)-2,5-dibromobenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
1,4-dibromo-2,5-bis(2-chloroethoxy)benzene (CAS 178557-12-5) is a chemical compound with the molecular formula C10H10Br2Cl2O2 and a molecular weight of 392.90 g/mol. IUPAC name: 1,4-dibromo-2,5-bis(2-chloroethoxy)benzene. InChIKey: IGJLUNFUSYBNGH-UHFFFAOYSA-N.
| Molecular formula | C10H10Br2Cl2O2 |
|---|---|
| Molecular weight | 392.90 g/mol |
| IUPAC name | 1,4-dibromo-2,5-bis(2-chloroethoxy)benzene |
| InChIKey | IGJLUNFUSYBNGH-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Br)OCCCl)Br)OCCCl |
Computed by PubChem (NCBI)