CAS 1785761-56-9 is the registry number for 2-(2,3-Dihydroxy-3-methylbutyl)-1h-isoindole-1,3(2h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2,3-dihydroxy-3-methylbutyl)isoindole-1,3-dione (CAS 1785761-56-9) is a chemical compound with the molecular formula C13H15NO4 and a molecular weight of 249.26 g/mol. IUPAC name: 2-(2,3-dihydroxy-3-methylbutyl)isoindole-1,3-dione. InChIKey: AKILRTMGKKCEBP-UHFFFAOYSA-N.
| Molecular formula | C13H15NO4 |
|---|---|
| Molecular weight | 249.26 g/mol |
| IUPAC name | 2-(2,3-dihydroxy-3-methylbutyl)isoindole-1,3-dione |
| InChIKey | AKILRTMGKKCEBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C(CN1C(=O)C2=CC=CC=C2C1=O)O)O |
Computed by PubChem (NCBI)