Products 1785761-82-1

CAS 1785761-82-1 is the registry number for 1-(6-Bromo-1H-indazol-3-yl)-5-oxopyrrolidine-3-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1-(6-bromo-1H-indazol-3-yl)-5-oxopyrrolidine-3-carboxylic acid (CAS 1785761-82-1) is a chemical compound with the molecular formula C12H10BrN3O3 and a molecular weight of 324.13 g/mol. IUPAC name: 1-(6-bromo-1H-indazol-3-yl)-5-oxopyrrolidine-3-carboxylic acid. InChIKey: AITKSAIKAXTKSG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10BrN3O3
Molecular weight324.13 g/mol
IUPAC name1-(6-bromo-1H-indazol-3-yl)-5-oxopyrrolidine-3-carboxylic acid
InChIKeyAITKSAIKAXTKSG-UHFFFAOYSA-N
SMILESC1C(CN(C1=O)C2=NNC3=C2C=CC(=C3)Br)C(=O)O

Computed by PubChem (NCBI)