Products 1786-03-4
CAS 1786-03-4 appears in our catalog under these names: 2-(Naphthalen-1-yl)-1H-indene-1,3(2H)-dione, 98%, Naphthylin. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
2-naphthalen-1-ylindene-1,3-dione (CAS 1786-03-4) is a chemical compound with the molecular formula C19H12O2 and a molecular weight of 272.3 g/mol. IUPAC name: 2-naphthalen-1-ylindene-1,3-dione. InChIKey: CVLPPWGDNNZTRW-UHFFFAOYSA-N.
| Molecular formula | C19H12O2 |
|---|---|
| Molecular weight | 272.3 g/mol |
| IUPAC name | 2-naphthalen-1-ylindene-1,3-dione |
| InChIKey | CVLPPWGDNNZTRW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2C3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)
Synonyms:
2-(1-Naphthalenyl)-1H-indene-1,3(2H)-dione, Naphthylin, Radione, 2-naphthalen-1-ylindene-1,3-dione, 2-(naphthalen-1-yl)-1H-indene-1,3(2H)-dione, 1,3-Indandione, 2-(1-naphthyl)-, 2-(1-Naphthyl)-1H-indene-1,3(2H)-dione, 2-alpha-Naphtylindandione-1,3, naphthylindane-1,3-diones, 2-alpha-Naftyloindandion-1,3 [Polish]