CAS 178619-87-9 is the registry number for 2,3,6,7-Tetrachloro-5-nitroquinoxaline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3,6,7-tetrachloro-5-nitroquinoxaline (CAS 178619-87-9) is a chemical compound with the molecular formula C8HCl4N3O2 and a molecular weight of 312.9 g/mol. IUPAC name: 2,3,6,7-tetrachloro-5-nitroquinoxaline. InChIKey: GYQDMMSNDKWZLY-UHFFFAOYSA-N.
| Molecular formula | C8HCl4N3O2 |
|---|---|
| Molecular weight | 312.9 g/mol |
| IUPAC name | 2,3,6,7-tetrachloro-5-nitroquinoxaline |
| InChIKey | GYQDMMSNDKWZLY-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(C(=C1Cl)Cl)[N+](=O)[O-])N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)