CAS 1786209-63-9 appears in our catalog under these names: Ethyl 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetate hydrochloride, 95%, Ethyl 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetate hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 250mg, 1g, 2,5g.
Ethyl 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetate;hydrochloride (CAS 1786209-63-9) is a chemical compound with the molecular formula C13H16Cl3NO2 and a molecular weight of 324.6 g/mol. IUPAC name: ethyl 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetate;hydrochloride. InChIKey: MEKOTMLSZDVCNF-UHFFFAOYSA-N.
| Molecular formula | C13H16Cl3NO2 |
|---|---|
| Molecular weight | 324.6 g/mol |
| IUPAC name | ethyl 2-(cyclopropylamino)-2-(2,4-dichlorophenyl)acetate;hydrochloride |
| InChIKey | MEKOTMLSZDVCNF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C1=C(C=C(C=C1)Cl)Cl)NC2CC2.Cl |
Computed by PubChem (NCBI)