CAS 1786401-70-4 is the registry number for (R)-I-BET762 carboxylic acid, 99.50%. Offered by: MedChemExpress. Available pack sizes: 100 mg, 5 mg, 25 mg, 10 mg, 50 mg.
2-[(4R)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetic acid (CAS 1786401-70-4) is a chemical compound with the molecular formula C20H17ClN4O3 and a molecular weight of 396.8 g/mol. IUPAC name: 2-[(4R)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetic acid. InChIKey: VEIZLTSJCDOIBH-MRXNPFEDSA-N.
| Molecular formula | C20H17ClN4O3 |
|---|---|
| Molecular weight | 396.8 g/mol |
| IUPAC name | 2-[(4R)-6-(4-chlorophenyl)-8-methoxy-1-methyl-4H-[1,2,4]triazolo[4,3-a][1,4]benzodiazepin-4-yl]acetic acid |
| InChIKey | VEIZLTSJCDOIBH-MRXNPFEDSA-N |
| SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)OC)C(=N[C@@H]2CC(=O)O)C4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)