CAS 1786429-62-6 is the registry number for 2-([1,1'-Biphenyl]-3-ylmethyl)isothiouronium bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 200mg.
(3-phenylphenyl)methyl carbamimidothioate;hydrobromide (CAS 1786429-62-6) is a chemical compound with the molecular formula C14H15BrN2S and a molecular weight of 323.25 g/mol. IUPAC name: (3-phenylphenyl)methyl carbamimidothioate;hydrobromide. InChIKey: ZMBUYHATBSPOOM-UHFFFAOYSA-N.
| Molecular formula | C14H15BrN2S |
|---|---|
| Molecular weight | 323.25 g/mol |
| IUPAC name | (3-phenylphenyl)methyl carbamimidothioate;hydrobromide |
| InChIKey | ZMBUYHATBSPOOM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)CSC(=N)N.Br |
Computed by PubChem (NCBI)