CAS 17866-84-1 appears in our catalog under these names: Terephthalbis(4–fluoroaniline), 1,1'-(1,4-Phenylene)bis(N-(4-fluorophenyl)methanimine) 98%, Terepthalbis(4-fluoroaniline), 98%. Offered by: GLPBio, Ambeed, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
N-(4-fluorophenyl)-1-[4-[(4-fluorophenyl)iminomethyl]phenyl]methanimine (CAS 17866-84-1) is a chemical compound with the molecular formula C20H14F2N2 and a molecular weight of 320.3 g/mol. IUPAC name: N-(4-fluorophenyl)-1-[4-[(4-fluorophenyl)iminomethyl]phenyl]methanimine. InChIKey: VBCDABROGMPOGB-UHFFFAOYSA-N.
| Molecular formula | C20H14F2N2 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | N-(4-fluorophenyl)-1-[4-[(4-fluorophenyl)iminomethyl]phenyl]methanimine |
| InChIKey | VBCDABROGMPOGB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=NC2=CC=C(C=C2)F)C=NC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)