CAS 178666-56-3 is the registry number for Sodium 4-fluorophenylacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Sodium 2-(4-fluorophenyl)acetate (CAS 178666-56-3) is a chemical compound with the molecular formula C8H6FNaO2 and a molecular weight of 176.12 g/mol. IUPAC name: sodium 2-(4-fluorophenyl)acetate. InChIKey: YWQXFWPYMSNCQM-UHFFFAOYSA-M.
| Molecular formula | C8H6FNaO2 |
|---|---|
| Molecular weight | 176.12 g/mol |
| IUPAC name | sodium 2-(4-fluorophenyl)acetate |
| InChIKey | YWQXFWPYMSNCQM-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1CC(=O)[O-])F.[Na+] |
Computed by PubChem (NCBI)