CAS 178671-74-4 appears in our catalog under these names: Decitabine Impurity 4, Decitabine Impurity 46, Decitabine Impurity 17. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
1-(diaminomethylidene)-3-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]urea (CAS 178671-74-4) is a chemical compound with the molecular formula C7H14N4O4 and a molecular weight of 218.21 g/mol. IUPAC name: 1-(diaminomethylidene)-3-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]urea. InChIKey: VGUQMXPKKFTIJO-LMVFSUKVSA-N.
| Molecular formula | C7H14N4O4 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 1-(diaminomethylidene)-3-[(2S,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]urea |
| InChIKey | VGUQMXPKKFTIJO-LMVFSUKVSA-N |
| SMILES | C1[C@@H]([C@H](O[C@@H]1NC(=O)N=C(N)N)CO)O |
Computed by PubChem (NCBI)