CAS 1787-44-6 appears in our catalog under these names: Methyl-d3-triphenylphosphonium Bromide, >95% (HPLC), Methyl-d3-triphenylphosphonium Bromide, 99 atom % D, min 98% Chemical Purity, Methyl–triphenylphosphonium–d3 bromide, METHYL-D3-TRIPHENYLPHOSPHONIUM BROMIDE,&, Methyl-triphenylphosphonium-d3 (bromide), 99.0%. Offered by: TRC, CDN, GLPBio, Sigma-Aldrich, MedChemExpress. Available pack sizes: 100mg, 1g, 500mg, 5g, 10g, 1 g, 100 mg.
Triphenyl(trideuteriomethyl)phosphanium bromide (CAS 1787-44-6) is a chemical compound with the molecular formula C19H18BrP and a molecular weight of 360.2 g/mol. IUPAC name: triphenyl(trideuteriomethyl)phosphanium bromide. InChIKey: LSEFCHWGJNHZNT-NIIDSAIPSA-M.
| Molecular formula | C19H18BrP |
|---|---|
| Molecular weight | 360.2 g/mol |
| IUPAC name | triphenyl(trideuteriomethyl)phosphanium bromide |
| InChIKey | LSEFCHWGJNHZNT-NIIDSAIPSA-M |
| SMILES | [2H]C([2H])([2H])[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)