CAS 17875-55-7 appears in our catalog under these names: 1,1,5,5–Tetramethyl–3,3–diphenyltrisiloxane, 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane, >98.0%(GC), 1,1,5,5-Tetramethyl-3,3-diphenyltrisiloxane 98%, 1,1,5,5-TETRAMETHYL-3,3-DIPHENYL TRISILOXANE, 97%(GC). Offered by: GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 1000g.
CAS 17875-55-7 identifies a chemical compound with the molecular formula C16H22O2Si3 and a molecular weight of 330.60 g/mol. InChIKey: BSXVSQHDSNEHCJ-UHFFFAOYSA-N.
| Molecular formula | C16H22O2Si3 |
|---|---|
| Molecular weight | 330.60 g/mol |
| InChIKey | BSXVSQHDSNEHCJ-UHFFFAOYSA-N |
| SMILES | C[Si](C)O[Si](C1=CC=CC=C1)(C2=CC=CC=C2)O[Si](C)C |
Computed by PubChem (NCBI)