CAS 1787881-30-4 is the registry number for 3-(2,2-Difluoroethoxy)-4-nitro-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-(2,2-difluoroethoxy)-4-nitro-1H-pyrazole (CAS 1787881-30-4) is a chemical compound with the molecular formula C5H5F2N3O3 and a molecular weight of 193.11 g/mol. IUPAC name: 5-(2,2-difluoroethoxy)-4-nitro-1H-pyrazole. InChIKey: IVZGNFMNYGCHAS-UHFFFAOYSA-N.
| Molecular formula | C5H5F2N3O3 |
|---|---|
| Molecular weight | 193.11 g/mol |
| IUPAC name | 5-(2,2-difluoroethoxy)-4-nitro-1H-pyrazole |
| InChIKey | IVZGNFMNYGCHAS-UHFFFAOYSA-N |
| SMILES | C1=NNC(=C1[N+](=O)[O-])OCC(F)F |
Computed by PubChem (NCBI)