CAS 1788041-43-9 appears in our catalog under these names: (1R,2S,5S)-Rel-3-azabicyclo[3.1.0]hexane-2-methanol hydrochloride, 95%, (1R,2S,5S)-rel-3-Azabicyclo(3.1.0)hexan-2-ylmethanol hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
[(1R,2S,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanol;hydrochloride (CAS 1788041-43-9) is a chemical compound with the molecular formula C6H12ClNO and a molecular weight of 149.62 g/mol. IUPAC name: [(1R,2S,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanol;hydrochloride. InChIKey: YGLZZVXDLDVFDA-RWOHWRPJSA-N.
| Molecular formula | C6H12ClNO |
|---|---|
| Molecular weight | 149.62 g/mol |
| IUPAC name | [(1R,2S,5S)-3-azabicyclo[3.1.0]hexan-2-yl]methanol;hydrochloride |
| InChIKey | YGLZZVXDLDVFDA-RWOHWRPJSA-N |
| SMILES | C1[C@H]2[C@@H]1[C@H](NC2)CO.Cl |
Computed by PubChem (NCBI)