CAS 1788041-46-2 is the registry number for 3-(Aminomethyl)-1-[(tert-butoxy)carbonyl]azetidine-3-carboxylic acid hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(aminomethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid;hydrochloride (CAS 1788041-46-2) is a chemical compound with the molecular formula C10H19ClN2O4 and a molecular weight of 266.72 g/mol. IUPAC name: 3-(aminomethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid;hydrochloride. InChIKey: JEHMDWIPUWGPFX-UHFFFAOYSA-N.
| Molecular formula | C10H19ClN2O4 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | 3-(aminomethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidine-3-carboxylic acid;hydrochloride |
| InChIKey | JEHMDWIPUWGPFX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(CN)C(=O)O.Cl |
Computed by PubChem (NCBI)