CAS 1788041-68-8 appears in our catalog under these names: 4,4,5,5-Tetrachlorospiro[2.2]pentane-1-carboxylic acid, 95%, 4,4,5,5-Tetrachlorospiro(2.2)pentane-1-carboxylic acid, 97%, 4,4,5,5-Tetrachlorospiro[2.2]pentane-1-carboxylic acid, 97%, 97%, 4,4,5,5-TETRACHLOROSPIRO[2.2]PENTANE-1-CARBOXYLIC ACID, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 500mg.
1,1,2,2-tetrachlorospiro[2.2]pentane-5-carboxylic acid (CAS 1788041-68-8) is a chemical compound with the molecular formula C6H4Cl4O2 and a molecular weight of 249.9 g/mol. IUPAC name: 1,1,2,2-tetrachlorospiro[2.2]pentane-5-carboxylic acid. InChIKey: OAXSBVCQAMQFKW-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl4O2 |
|---|---|
| Molecular weight | 249.9 g/mol |
| IUPAC name | 1,1,2,2-tetrachlorospiro[2.2]pentane-5-carboxylic acid |
| InChIKey | OAXSBVCQAMQFKW-UHFFFAOYSA-N |
| SMILES | C1C(C12C(C2(Cl)Cl)(Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)