CAS 1788055-11-7 appears in our catalog under these names: VU0486846, 98%, VU0486846, VU0486846, 99.5%. Offered by: Chemat Brand, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 50mg, 25mg, 100mg, 1 mg, 5 mg.
(2R)-N-[(1S,2S)-2-hydroxycyclohexyl]-4-[(4-pyrazol-1-ylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide (CAS 1788055-11-7) is a chemical compound with the molecular formula C25H28N4O3 and a molecular weight of 432.5 g/mol. IUPAC name: (2R)-N-[(1S,2S)-2-hydroxycyclohexyl]-4-[(4-pyrazol-1-ylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide. InChIKey: LZCHTDQRMCSDSE-ODGPQVTHSA-N.
| Molecular formula | C25H28N4O3 |
|---|---|
| Molecular weight | 432.5 g/mol |
| IUPAC name | (2R)-N-[(1S,2S)-2-hydroxycyclohexyl]-4-[(4-pyrazol-1-ylphenyl)methyl]-2,3-dihydro-1,4-benzoxazine-2-carboxamide |
| InChIKey | LZCHTDQRMCSDSE-ODGPQVTHSA-N |
| SMILES | C1CC[C@@H]([C@H](C1)NC(=O)[C@H]2CN(C3=CC=CC=C3O2)CC4=CC=C(C=C4)N5C=CC=N5)O |
Computed by PubChem (NCBI)