CAS 17881-95-7 appears in our catalog under these names: 3-(Trimethylsilyl)phenol, 96%, 3-(Trimethylsilyl)phenol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-trimethylsilylphenol (CAS 17881-95-7) is a chemical compound with the molecular formula C9H14OSi and a molecular weight of 166.29 g/mol. IUPAC name: 3-trimethylsilylphenol. InChIKey: ZZSAAXNTJKNMDX-UHFFFAOYSA-N.
| Molecular formula | C9H14OSi |
|---|---|
| Molecular weight | 166.29 g/mol |
| IUPAC name | 3-trimethylsilylphenol |
| InChIKey | ZZSAAXNTJKNMDX-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)C1=CC=CC(=C1)O |
Computed by PubChem (NCBI)