Products 1788104-76-6
CAS 1788104-76-6 is the registry number for (S)-6-chloro-7-methyl-2-(2-methylpyrrolidin-2-yl)-1H-benzo[d]imidazole hydrochloride, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
5-chloro-4-methyl-2-[(2S)-2-methylpyrrolidin-2-yl]-1H-benzimidazole;hydrochloride (CAS 1788104-76-6) is a chemical compound with the molecular formula C13H17Cl2N3 and a molecular weight of 286.20 g/mol. IUPAC name: 5-chloro-4-methyl-2-[(2S)-2-methylpyrrolidin-2-yl]-1H-benzimidazole;hydrochloride. InChIKey: OSFVHBSKNUZBTN-ZOWNYOTGSA-N.
| Molecular formula | C13H17Cl2N3 |
|---|---|
| Molecular weight | 286.20 g/mol |
| IUPAC name | 5-chloro-4-methyl-2-[(2S)-2-methylpyrrolidin-2-yl]-1H-benzimidazole;hydrochloride |
| InChIKey | OSFVHBSKNUZBTN-ZOWNYOTGSA-N |
| SMILES | CC1=C(C=CC2=C1N=C(N2)[C@@]3(CCCN3)C)Cl.Cl |
Computed by PubChem (NCBI)