CAS 928026-67-9 appears in our catalog under these names: 2-(Piperazin-1-yl)quinoline dihydrochloride, 95%, 2-(Piperazin-1-yl)quinoline dihydrochloride, 98+%, 2-(Piperazin-1-yl)quinoline dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
2-piperazin-1-ylquinoline;dihydrochloride (CAS 928026-67-9) is a chemical compound with the molecular formula C13H17Cl2N3 and a molecular weight of 286.20 g/mol. IUPAC name: 2-piperazin-1-ylquinoline;dihydrochloride. InChIKey: NKSMLXMNONDXGH-UHFFFAOYSA-N.
| Molecular formula | C13H17Cl2N3 |
|---|---|
| Molecular weight | 286.20 g/mol |
| IUPAC name | 2-piperazin-1-ylquinoline;dihydrochloride |
| InChIKey | NKSMLXMNONDXGH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=CC=CC=C3C=C2.Cl.Cl |
Computed by PubChem (NCBI)