CAS 17882-43-8 is the registry number for (2S,5R)-5-Methyl-2-prop-1-en-2-ylcyclohexan-1-one. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg.
Trans-(2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-one (CAS 17882-43-8) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: trans-(2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-one. InChIKey: RMIANEGNSBUGDJ-BDAKNGLRSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | trans-(2S,5R)-5-methyl-2-prop-1-en-2-ylcyclohexan-1-one |
| InChIKey | RMIANEGNSBUGDJ-BDAKNGLRSA-N |
| SMILES | C[C@@H]1CC[C@H](C(=O)C1)C(=C)C |
Computed by PubChem (NCBI)