CAS 17882-94-9 appears in our catalog under these names: 1,3-Diethyl-1,1,3,3-tetramethyldisilazane, 95%, 1,3–Diethyl–1,1,3,3–tetramethyldisilazane, 1,3-Diethyl-1,1,3,3-tetramethyldisilazane, 1,3-Diethyl-1,1,3,3-tetramethyldisilazane, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem. Available pack sizes: 1g, 10g, 5g, 2g.
[[[ethyl(dimethyl)silyl]amino]-dimethylsilyl]ethane (CAS 17882-94-9) is a chemical compound with the molecular formula C8H23NSi2 and a molecular weight of 189.45 g/mol. IUPAC name: [[[ethyl(dimethyl)silyl]amino]-dimethylsilyl]ethane. InChIKey: MHRNQQUEUYMEEH-UHFFFAOYSA-N.
| Molecular formula | C8H23NSi2 |
|---|---|
| Molecular weight | 189.45 g/mol |
| IUPAC name | [[[ethyl(dimethyl)silyl]amino]-dimethylsilyl]ethane |
| InChIKey | MHRNQQUEUYMEEH-UHFFFAOYSA-N |
| SMILES | CC[Si](C)(C)N[Si](C)(C)CC |
Computed by PubChem (NCBI)