CAS 1788530-14-2 appears in our catalog under these names: 3-(1-Methyl-1H-pyrazol-4-yl)thiomorpholine 1,1-dioxide dihydrochloride, 98%, 3-(1-Methyl-1H-pyrazol-4-yl)-1λâ¶-thiomorpholine-1,1-dione dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(1-methylpyrazol-4-yl)-1,4-thiazinane 1,1-dioxide;dihydrochloride (CAS 1788530-14-2) is a chemical compound with the molecular formula C8H15Cl2N3O2S and a molecular weight of 288.19 g/mol. IUPAC name: 3-(1-methylpyrazol-4-yl)-1,4-thiazinane 1,1-dioxide;dihydrochloride. InChIKey: OFXMGCMFQCNBNX-UHFFFAOYSA-N.
| Molecular formula | C8H15Cl2N3O2S |
|---|---|
| Molecular weight | 288.19 g/mol |
| IUPAC name | 3-(1-methylpyrazol-4-yl)-1,4-thiazinane 1,1-dioxide;dihydrochloride |
| InChIKey | OFXMGCMFQCNBNX-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2CS(=O)(=O)CCN2.Cl.Cl |
Computed by PubChem (NCBI)