CAS 17887-80-8 appears in our catalog under these names: 1,3–Bis(trimethylsilyloxy)propane, 1,3-Bis(trimethylsilyloxy)propane, >98.0%(GC), 2,2,8,8-Tetramethyl-3,7-dioxa-2,8-disilanonane 95% GC, 2,2,8,8-Tetramethyl-3,7-dioxa-2,8-disilanonane, 95% GC, 95% GC, 2,2,8,8-Tetramethyl-3,7-dioxa-2,8-disilanonane, 96%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 10g, 50g.
Trimethyl(3-trimethylsilyloxypropoxy)silane (CAS 17887-80-8) is a chemical compound with the molecular formula C9H24O2Si2 and a molecular weight of 220.46 g/mol. IUPAC name: trimethyl(3-trimethylsilyloxypropoxy)silane. InChIKey: DWHYMKOUICVFHL-UHFFFAOYSA-N.
| Molecular formula | C9H24O2Si2 |
|---|---|
| Molecular weight | 220.46 g/mol |
| IUPAC name | trimethyl(3-trimethylsilyloxypropoxy)silane |
| InChIKey | DWHYMKOUICVFHL-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)OCCCO[Si](C)(C)C |
Computed by PubChem (NCBI)