CAS 1788823-11-9 appears in our catalog under these names: 3-(4-Iodo-3,5-dimethyl-1H-pyrazol-1-yl)tetrahydrothiophene 1,1-dioxide hydrochloride, 95%, 3-(4-Iodo-3,5-dimethyl-1H-pyrazol-1-yl)-1λâ¶-thiolane-1,1-dione hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(4-iodo-3,5-dimethylpyrazol-1-yl)thiolane 1,1-dioxide;hydrochloride (CAS 1788823-11-9) is a chemical compound with the molecular formula C9H14ClIN2O2S and a molecular weight of 376.64 g/mol. IUPAC name: 3-(4-iodo-3,5-dimethylpyrazol-1-yl)thiolane 1,1-dioxide;hydrochloride. InChIKey: SQIRAROKVOXYRW-UHFFFAOYSA-N.
| Molecular formula | C9H14ClIN2O2S |
|---|---|
| Molecular weight | 376.64 g/mol |
| IUPAC name | 3-(4-iodo-3,5-dimethylpyrazol-1-yl)thiolane 1,1-dioxide;hydrochloride |
| InChIKey | SQIRAROKVOXYRW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1C2CCS(=O)(=O)C2)C)I.Cl |
Computed by PubChem (NCBI)