CAS 1788901-86-9 appears in our catalog under these names: Lenvatinib N-Oxide, Lenvatinib N-Oxide, >95% (HPLC), Lenvatinib Impurity 5 95%, Lenvatinib N-Oxide, 95%, 95%. Offered by: Chemat Brand, TRC, Ambeed, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 100mg, 250mg, 1g, 1 mg.
4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-7-methoxy-1-oxidoquinolin-1-ium-6-carboxamide (CAS 1788901-86-9) is a chemical compound with the molecular formula C21H19ClN4O5 and a molecular weight of 442.9 g/mol. IUPAC name: 4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-7-methoxy-1-oxidoquinolin-1-ium-6-carboxamide. InChIKey: PLCPYTNTMUKPOL-UHFFFAOYSA-N.
| Molecular formula | C21H19ClN4O5 |
|---|---|
| Molecular weight | 442.9 g/mol |
| IUPAC name | 4-[3-chloro-4-(cyclopropylcarbamoylamino)phenoxy]-7-methoxy-1-oxidoquinolin-1-ium-6-carboxamide |
| InChIKey | PLCPYTNTMUKPOL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=[N+](C=CC(=C2C=C1C(=O)N)OC3=CC(=C(C=C3)NC(=O)NC4CC4)Cl)[O-] |
Computed by PubChem (NCBI)