CAS 178962-09-9 is the registry number for (2R,4S)-Methyl 4-hydroxypyrrolidine-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Methyl (2R,4S)-4-hydroxypyrrolidine-2-carboxylate (CAS 178962-09-9) is a chemical compound with the molecular formula C6H11NO3 and a molecular weight of 145.16 g/mol. IUPAC name: methyl (2R,4S)-4-hydroxypyrrolidine-2-carboxylate. InChIKey: ZORHSASAYVIBLY-CRCLSJGQSA-N.
| Molecular formula | C6H11NO3 |
|---|---|
| Molecular weight | 145.16 g/mol |
| IUPAC name | methyl (2R,4S)-4-hydroxypyrrolidine-2-carboxylate |
| InChIKey | ZORHSASAYVIBLY-CRCLSJGQSA-N |
| SMILES | COC(=O)[C@H]1C[C@@H](CN1)O |
Computed by PubChem (NCBI)