Products 178979-85-6
CAS 178979-85-6 is the registry number for Capravirine. Offered by: MedChemExpress. Available pack sizes: Get quote.
[5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methyl carbamate (CAS 178979-85-6) is a chemical compound with the molecular formula C20H20Cl2N4O2S and a molecular weight of 451.4 g/mol. IUPAC name: [5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methyl carbamate. InChIKey: YQXCVAGCMNFUMQ-UHFFFAOYSA-N.
| Molecular formula | C20H20Cl2N4O2S |
|---|---|
| Molecular weight | 451.4 g/mol |
| IUPAC name | [5-(3,5-dichlorophenyl)sulfanyl-4-propan-2-yl-1-(pyridin-4-ylmethyl)imidazol-2-yl]methyl carbamate |
| InChIKey | YQXCVAGCMNFUMQ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(N(C(=N1)COC(=O)N)CC2=CC=NC=C2)SC3=CC(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)