CAS 17900-11-7 is the registry number for 2-(4-Chlorophenyl)-6-fluoro-4-carboxyquinoline, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
2-(4-chlorophenyl)-6-fluoroquinoline-4-carboxylic acid (CAS 17900-11-7) is a chemical compound with the molecular formula C16H9ClFNO2 and a molecular weight of 301.70 g/mol. IUPAC name: 2-(4-chlorophenyl)-6-fluoroquinoline-4-carboxylic acid. InChIKey: INPQMFGLMYDYCM-UHFFFAOYSA-N.
| Molecular formula | C16H9ClFNO2 |
|---|---|
| Molecular weight | 301.70 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-6-fluoroquinoline-4-carboxylic acid |
| InChIKey | INPQMFGLMYDYCM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(C=C(C=C3)F)C(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)